مسحوق Urolithin B.

نوفمبر 9، 2020

يوروليثين BSpecifications

الإسم: Urolithin ب
اسم المادة الكيميائية: 3-هيدروكسي-6 ح-ثنائي بنزو [ب ، د] بيران-6-وان
CAS: 1139-83-9
الصيغة الكيميائية: C13H8O3
الوزن الجزيئي الغرامي: X
اللون:  مسحوق أبيض
مفتاح InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
كود SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
وظيفة: يمكن أن يحسن Urolithin B وظائف الميتوكوندريا والعضلات.

يمكن أن يحسن Urolithin B قوة العضلات والقدرة على التحمل أثناء الشيخوخة.

تطبيق: Urolithin B هو مستقلب جرثومي معوي من ellagitannis ويعرض أنشطة فعالة مضادة للأكسدة ومؤيدة للأكسدة اعتمادًا على نظام الفحص والظروف. يمكن أن يظهر Urolithin B أيضًا نشاطًا استروجينيًا و / أو مضادًا للاستروجين.
الذوبان: قابل للذوبان بسهولة في N و N-dimethylformamide و dimethylmethylene. سلفون ، قابل للذوبان بشكل طفيف في الميثانول والإيثانول وخلات الإيثيل
درجة حرارة التخزين: استرطابي ، -20 ° C فريزر ، تحت جو خامل
حالة الشحن: يتم شحنها تحت درجة الحرارة المحيطة كمواد كيميائية غير خطرة. هذا المنتج ثابت بما فيه الكفاية لبضعة أسابيع خلال الشحن العادي والوقت الذي يقضيه في الجمارك.

 

Urolithin ب طيف الرنين المغناطيسي النووي

Urolithin B (1139-83-9) - طيف الرنين المغناطيسي النووي

 

إذا كنت بحاجة إلى شهادات توثيق البرامج ، MSDS ، HNMR لكل دفعة من المنتجات وغيرها من المعلومات ، فيرجى الاتصال بنا مدير التسويق.